C28H31N3O5 — CID 129111351
[2-ethyl-7-methoxy-1-oxo-6-(2-quinolin-2-ylethoxy)isoquinolin-4-yl] N-butylcarbamate (PubChem CID 129111351) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is [2-ethyl-7-methoxy-1-oxo-6-(2-quinolin-2-ylethoxy)isoquinolin-4-yl] N-butylcarbamate.
| Compound Name | [2-ethyl-7-methoxy-1-oxo-6-(2-quinolin-2-ylethoxy)isoquinolin-4-yl] N-butylcarbamate |
|---|---|
| PubChem CID | 129111351 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | [2-ethyl-7-methoxy-1-oxo-6-(2-quinolin-2-ylethoxy)isoquinolin-4-yl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1cn(CC)c(=O)c2cc(OC)c(OCCc3ccc4ccccc4n3)cc12 |
| InChI | InChI=1S/C28H31N3O5/c1-4-6-14-29-28(33)36-26-18-31(5-2)27(32)22-17-24(34-3)25(16-21(22)26)35-15-13-20-12-11-19-9-7-8-10-23(19)30-20/h7-12,16-18H,4-6,13-15H2,1-3H3,(H,29,33) |
| InChIKey | OVUUJLRMOBTKIS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|