C37H33N3O7 — CID 18398965
methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate (PubChem CID 18398965) has the molecular formula C37H33N3O7 and a molecular weight of 631.69 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18398965 |
| Molecular Formula | C37H33N3O7 |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(C)c(OC)c2)c2cc(OC)c(OCc3ccc4ccccc4n3)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C37H33N3O7/c1-21-30(43-2)16-23(17-31(21)44-3)34-27-18-32(45-4)33(47-20-25-13-10-22-8-6-7-9-29(22)39-25)19-28(27)36(41)40(35(34)37(42)46-5)26-14-11-24(38)12-15-26/h6-19H,20,38H2,1-5H3 |
| InChIKey | UPWRBKNJYXMNOD-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|