C36H30BrN3O7 — CID 18398878
methyl 2-(4-aminophenyl)-4-(4-bromo-3,5-dimethoxyphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate (PubChem CID 18398878) has the molecular formula C36H30BrN3O7 and a molecular weight of 696.55 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(4-bromo-3,5-dimethoxyphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-4-(4-bromo-3,5-dimethoxyphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18398878 |
| Molecular Formula | C36H30BrN3O7 |
| Molecular Weight | 696.55 g/mol |
| Exact Mass | 695.13 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(4-bromo-3,5-dimethoxyphenyl)-6-methoxy-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(Br)c(OC)c2)c2cc(OC)c(OCc3ccc4ccccc4n3)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C36H30BrN3O7/c1-43-28-17-25-26(18-29(28)47-19-23-12-9-20-7-5-6-8-27(20)39-23)35(41)40(24-13-10-22(38)11-14-24)34(36(42)46-4)32(25)21-15-30(44-2)33(37)31(16-21)45-3/h5-18H,19,38H2,1-4H3 |
| InChIKey | HDONQRZJDGDSFH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.55 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|