C29H31ClN2O9 — CID 18398999
methyl 2-(4-aminophenyl)-7-(2-hydroxyethoxy)-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride (PubChem CID 18398999) has the molecular formula C29H31ClN2O9 and a molecular weight of 587.03 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-7-(2-hydroxyethoxy)-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-7-(2-hydroxyethoxy)-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18398999 |
| Molecular Formula | C29H31ClN2O9 |
| Molecular Weight | 587.03 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | methyl 2-(4-aminophenyl)-7-(2-hydroxyethoxy)-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OCCO)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C29H30N2O9.ClH/c1-35-21-14-19-20(15-22(21)40-11-10-32)28(33)31(18-8-6-17(30)7-9-18)26(29(34)39-5)25(19)16-12-23(36-2)27(38-4)24(13-16)37-3;/h6-9,12-15,32H,10-11,30H2,1-5H3;1H |
| InChIKey | YQTHJVCSOJFVCL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.03 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|