C35H34N2O9 — CID 18399339
methyl 2-(4-aminophenyl)-6-methoxy-7-[methoxy(phenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate (PubChem CID 18399339) has the molecular formula C35H34N2O9 and a molecular weight of 626.66 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-6-methoxy-7-[methoxy(phenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-6-methoxy-7-[methoxy(phenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18399339 |
| Molecular Formula | C35H34N2O9 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | methyl 2-(4-aminophenyl)-6-methoxy-7-[methoxy(phenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OC(OC)c3ccccc3)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C35H34N2O9/c1-40-26-18-24-25(19-27(26)46-35(45-6)20-10-8-7-9-11-20)33(38)37(23-14-12-22(36)13-15-23)31(34(39)44-5)30(24)21-16-28(41-2)32(43-4)29(17-21)42-3/h7-19,35H,36H2,1-6H3 |
| InChIKey | DIIWDNAKRGKMSQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|