C36H36N2O10 — CID 18399362
methyl 2-(4-aminophenyl)-7-[(2,3-dimethoxyphenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate (PubChem CID 18399362) has the molecular formula C36H36N2O10 and a molecular weight of 656.69 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-7-[(2,3-dimethoxyphenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-7-[(2,3-dimethoxyphenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18399362 |
| Molecular Formula | C36H36N2O10 |
| Molecular Weight | 656.69 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | methyl 2-(4-aminophenyl)-7-[(2,3-dimethoxyphenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OCc3cccc(OC)c3OC)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C36H36N2O10/c1-41-26-10-8-9-20(33(26)45-5)19-48-28-18-25-24(17-27(28)42-2)31(21-15-29(43-3)34(46-6)30(16-21)44-4)32(36(40)47-7)38(35(25)39)23-13-11-22(37)12-14-23/h8-18H,19,37H2,1-7H3 |
| InChIKey | MIOVMZWQMPETRD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|