C34H35Cl2N3O8 — CID 70074051
methyl 2-(4-aminophenyl)-7-[(3-aminophenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride (PubChem CID 70074051) has the molecular formula C34H35Cl2N3O8 and a molecular weight of 684.57 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-7-[(3-aminophenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-7-[(3-aminophenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 70074051 |
| Molecular Formula | C34H35Cl2N3O8 |
| Molecular Weight | 684.57 g/mol |
| Exact Mass | 683.18 |
| IUPAC Name | methyl 2-(4-aminophenyl)-7-[(3-aminophenyl)methoxy]-6-methoxy-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OCc3cccc(N)c3)cc2c(=O)n1-c1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C34H33N3O8.2ClH/c1-40-26-16-24-25(17-27(26)45-18-19-7-6-8-22(36)13-19)33(38)37(23-11-9-21(35)10-12-23)31(34(39)44-5)30(24)20-14-28(41-2)32(43-4)29(15-20)42-3;;/h6-17H,18,35-36H2,1-5H3;2*1H |
| InChIKey | PYWSVUOEYUCROC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|