C33H29N3O9 — CID 18399307
methyl 2-(4-aminophenyl)-7-[(3-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate (PubChem CID 18399307) has the molecular formula C33H29N3O9 and a molecular weight of 611.61 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-7-[(3-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-7-[(3-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18399307 |
| Molecular Formula | C33H29N3O9 |
| Molecular Weight | 611.61 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | methyl 2-(4-aminophenyl)-7-[(3-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc(OCc3cccc([N+](=O)[O-])c3)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C33H29N3O9/c1-41-27-15-20(16-28(42-2)31(27)43-3)29-25-13-12-24(45-18-19-6-5-7-23(14-19)36(39)40)17-26(25)32(37)35(30(29)33(38)44-4)22-10-8-21(34)9-11-22/h5-17H,18,34H2,1-4H3 |
| InChIKey | OZQLGJUZUUWXMA-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|