C32H28ClN3O7 — CID 18399044
methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[[6-(hydroxymethyl)-2-pyridinyl]methoxy]-1-oxoisoquinoline-3-carboxylate (PubChem CID 18399044) has the molecular formula C32H28ClN3O7 and a molecular weight of 602.04 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[[6-(hydroxymethyl)-2-pyridinyl]methoxy]-1-oxoisoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[[6-(hydroxymethyl)-2-pyridinyl]methoxy]-1-oxoisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18399044 |
| Molecular Formula | C32H28ClN3O7 |
| Molecular Weight | 602.04 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-7-[[6-(hydroxymethyl)-2-pyridinyl]methoxy]-1-oxoisoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(Cl)c(OC)c2)c2ccc(OCc3cccc(CO)n3)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C32H28ClN3O7/c1-40-26-13-18(14-27(41-2)29(26)33)28-24-12-11-23(43-17-21-6-4-5-20(16-37)35-21)15-25(24)31(38)36(30(28)32(39)42-3)22-9-7-19(34)8-10-22/h4-15,37H,16-17,34H2,1-3H3 |
| InChIKey | IEYFQIHECATOLZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.04 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|