C35H30Cl3N3O6 — CID 18398904
methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate;dihydrochloride (PubChem CID 18398904) has the molecular formula C35H30Cl3N3O6 and a molecular weight of 695.00 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate;dihydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 18398904 |
| Molecular Formula | C35H30Cl3N3O6 |
| Molecular Weight | 695.00 g/mol |
| Exact Mass | 693.12 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(4-chloro-3,5-dimethoxyphenyl)-1-oxo-7-(quinolin-2-ylmethoxy)isoquinoline-3-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(Cl)c(OC)c2)c2ccc(OCc3ccc4ccccc4n3)cc2c(=O)n1-c1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C35H28ClN3O6.2ClH/c1-42-29-16-21(17-30(43-2)32(29)36)31-26-15-14-25(45-19-23-11-8-20-6-4-5-7-28(20)38-23)18-27(26)34(40)39(33(31)35(41)44-3)24-12-9-22(37)10-13-24;;/h4-18H,19,37H2,1-3H3;2*1H |
| InChIKey | XBQNOAQFKQGBOD-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.00 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|