C34H33ClN2O7 — CID 18398936
methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate;hydrochloride (PubChem CID 18398936) has the molecular formula C34H33ClN2O7 and a molecular weight of 617.10 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18398936 |
| Molecular Formula | C34H33ClN2O7 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.20 |
| IUPAC Name | methyl 2-(4-aminophenyl)-4-(3,5-dimethoxy-4-methylphenyl)-6-methoxy-1-oxo-7-phenylmethoxyisoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(C)c(OC)c2)c2cc(OC)c(OCc3ccccc3)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C34H32N2O7.ClH/c1-20-27(39-2)15-22(16-28(20)40-3)31-25-17-29(41-4)30(43-19-21-9-7-6-8-10-21)18-26(25)33(37)36(32(31)34(38)42-5)24-13-11-23(35)12-14-24;/h6-18H,19,35H2,1-5H3;1H |
| InChIKey | QEHITLVZDXLRRB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|