C33H31N3O8 — CID 18399185
methyl 2-(4-aminophenyl)-7-methoxy-1-oxo-6-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate (PubChem CID 18399185) has the molecular formula C33H31N3O8 and a molecular weight of 597.62 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-7-methoxy-1-oxo-6-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate.
| Compound Name | methyl 2-(4-aminophenyl)-7-methoxy-1-oxo-6-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18399185 |
| Molecular Formula | C33H31N3O8 |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | methyl 2-(4-aminophenyl)-7-methoxy-1-oxo-6-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OCc3ccccn3)c(OC)cc2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C33H31N3O8/c1-39-25-17-24-23(16-26(25)44-18-21-8-6-7-13-35-21)29(19-14-27(40-2)31(42-4)28(15-19)41-3)30(33(38)43-5)36(32(24)37)22-11-9-20(34)10-12-22/h6-17H,18,34H2,1-5H3 |
| InChIKey | CLLHTUSNVASFJX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|