C32H31Cl2N3O7 — CID 18398930
methyl 2-(4-aminophenyl)-1-oxo-8-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride (PubChem CID 18398930) has the molecular formula C32H31Cl2N3O7 and a molecular weight of 640.52 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-1-oxo-8-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-1-oxo-8-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 18398930 |
| Molecular Formula | C32H31Cl2N3O7 |
| Molecular Weight | 640.52 g/mol |
| Exact Mass | 639.15 |
| IUPAC Name | methyl 2-(4-aminophenyl)-1-oxo-8-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;dihydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cccc(OCc3ccccn3)c2c(=O)n1-c1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C32H29N3O7.2ClH/c1-38-25-16-19(17-26(39-2)30(25)40-3)27-23-9-7-10-24(42-18-21-8-5-6-15-34-21)28(23)31(36)35(29(27)32(37)41-4)22-13-11-20(33)12-14-22;;/h5-17H,18,33H2,1-4H3;2*1H |
| InChIKey | RLZSHMFZIGKCEL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|