C32H29N3O7 — CID 67497202
2-(4-aminophenyl)-5-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylic acid (PubChem CID 67497202) has the molecular formula C32H29N3O7 and a molecular weight of 567.60 g/mol. Its IUPAC name is 2-(4-aminophenyl)-5-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylic acid.
| Compound Name | 2-(4-aminophenyl)-5-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67497202 |
| Molecular Formula | C32H29N3O7 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 2-(4-aminophenyl)-5-methyl-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylic acid |
| SMILES | COc1cc(-c2c(C(=O)O)n(-c3ccc(N)cc3)c(=O)c3cc(OCc4ccccn4)cc(C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C32H29N3O7/c1-18-13-23(42-17-21-7-5-6-12-34-21)16-24-27(18)28(19-14-25(39-2)30(41-4)26(15-19)40-3)29(32(37)38)35(31(24)36)22-10-8-20(33)9-11-22/h5-16H,17,33H2,1-4H3,(H,37,38) |
| InChIKey | NZVUDZJZDZBKQC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|