C31H28ClN3O7 — CID 11050209
[4-[3-carboxy-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinolin-2-yl]phenyl]azanium chloride (PubChem CID 11050209) has the molecular formula C31H28ClN3O7 and a molecular weight of 590.03 g/mol. Its IUPAC name is [4-[3-carboxy-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinolin-2-yl]phenyl]azanium chloride.
| Compound Name | [4-[3-carboxy-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinolin-2-yl]phenyl]azanium chloride |
|---|---|
| PubChem CID | 11050209 |
| Molecular Formula | C31H28ClN3O7 |
| Molecular Weight | 590.03 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | [4-[3-carboxy-1-oxo-7-(pyridin-2-ylmethoxy)-4-(3,4,5-trimethoxyphenyl)isoquinolin-2-yl]phenyl]azanium chloride |
| SMILES | COc1cc(-c2c(C(=O)O)n(-c3ccc([NH3+])cc3)c(=O)c3cc(OCc4ccccn4)ccc23)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C31H27N3O7.ClH/c1-38-25-14-18(15-26(39-2)29(25)40-3)27-23-12-11-22(41-17-20-6-4-5-13-33-20)16-24(23)30(35)34(28(27)31(36)37)21-9-7-19(32)8-10-21;/h4-16H,17,32H2,1-3H3,(H,36,37);1H |
| InChIKey | APYDJQMFAXVCGJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 136.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.03 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'} |
|---|