C25H23N3O7 — CID 139864350
methyl 7-(4-aminophenyl)-1-oxido-8-oxo-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridin-1-ium-6-carboxylate (PubChem CID 139864350) has the molecular formula C25H23N3O7 and a molecular weight of 477.47 g/mol. Its IUPAC name is methyl 7-(4-aminophenyl)-1-oxido-8-oxo-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridin-1-ium-6-carboxylate.
| Compound Name | methyl 7-(4-aminophenyl)-1-oxido-8-oxo-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridin-1-ium-6-carboxylate |
|---|---|
| PubChem CID | 139864350 |
| Molecular Formula | C25H23N3O7 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | methyl 7-(4-aminophenyl)-1-oxido-8-oxo-5-(3,4,5-trimethoxyphenyl)-1,7-naphthyridin-1-ium-6-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2ccc[n+]([O-])c2c(=O)n1-c1ccc(N)cc1 |
| InChI | InChI=1S/C25H23N3O7/c1-32-18-12-14(13-19(33-2)23(18)34-3)20-17-6-5-11-27(31)21(17)24(29)28(22(20)25(30)35-4)16-9-7-15(26)8-10-16/h5-13H,26H2,1-4H3 |
| InChIKey | QNAFSBKWSOIMQD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|