C34H32ClN3O10 — CID 70074026
methyl 2-(4-aminophenyl)-6-methoxy-7-[(4-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride (PubChem CID 70074026) has the molecular formula C34H32ClN3O10 and a molecular weight of 678.09 g/mol. Its IUPAC name is methyl 2-(4-aminophenyl)-6-methoxy-7-[(4-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride.
| Compound Name | methyl 2-(4-aminophenyl)-6-methoxy-7-[(4-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70074026 |
| Molecular Formula | C34H32ClN3O10 |
| Molecular Weight | 678.09 g/mol |
| Exact Mass | 677.18 |
| IUPAC Name | methyl 2-(4-aminophenyl)-6-methoxy-7-[(4-nitrophenyl)methoxy]-1-oxo-4-(3,4,5-trimethoxyphenyl)isoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)c1c(-c2cc(OC)c(OC)c(OC)c2)c2cc(OC)c(OCc3ccc([N+](=O)[O-])cc3)cc2c(=O)n1-c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C34H31N3O10.ClH/c1-42-26-16-24-25(17-27(26)47-18-19-6-10-23(11-7-19)37(40)41)33(38)36(22-12-8-21(35)9-13-22)31(34(39)46-5)30(24)20-14-28(43-2)32(45-4)29(15-20)44-3;/h6-17H,18,35H2,1-5H3;1H |
| InChIKey | WMZPRILEMQVVGL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.09 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|