C20H24F3N3O3 — CID 129112966
N-formyl-N-(3-hydroxypropyl)-3-(3-methylbutyl)-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxamide (PubChem CID 129112966) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-formyl-N-(3-hydroxypropyl)-3-(3-methylbutyl)-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxamide.
| Compound Name | N-formyl-N-(3-hydroxypropyl)-3-(3-methylbutyl)-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 129112966 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-formyl-N-(3-hydroxypropyl)-3-(3-methylbutyl)-2-[3-(trifluoromethyl)phenyl]imidazole-4-carboxamide |
| SMILES | CC(C)CCn1c(C(=O)N(C=O)CCCO)cnc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H24F3N3O3/c1-14(2)7-9-26-17(19(29)25(13-28)8-4-10-27)12-24-18(26)15-5-3-6-16(11-15)20(21,22)23/h3,5-6,11-14,27H,4,7-10H2,1-2H3 |
| InChIKey | KXGPHPJNAANXNY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|