C19H25ClN4O3 — CID 129113411
7-[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienyl]-8-ethyl-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione (PubChem CID 129113411) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is 7-[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienyl]-8-ethyl-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienyl]-8-ethyl-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 129113411 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 7-[(3Z,5E)-5-chloro-2-methylidenehepta-3,5-dienyl]-8-ethyl-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione |
| SMILES | C=C(/C=C\C(Cl)=C/C)Cn1c(CC)nc2c1c(=O)n(CCCO)c(=O)n2C |
| InChI | InChI=1S/C19H25ClN4O3/c1-5-14(20)9-8-13(3)12-24-15(6-2)21-17-16(24)18(26)23(10-7-11-25)19(27)22(17)4/h5,8-9,25H,3,6-7,10-12H2,1-2,4H3/b9-8-,14-5+ |
| InChIKey | ISUAETXKWMNOJI-KBZALZPKSA-N |
| XLogP | 2.10 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|