C20H29N5O4 — CID 123802920
8-ethoxy-1-(3-hydroxypropyl)-3-methyl-7-[(2E)-3-methyl-2-[(propan-2-ylideneamino)methylidene]but-3-enyl]purine-2,6-dione (PubChem CID 123802920) has the molecular formula C20H29N5O4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 8-ethoxy-1-(3-hydroxypropyl)-3-methyl-7-[(2E)-3-methyl-2-[(propan-2-ylideneamino)methylidene]but-3-enyl]purine-2,6-dione.
| Compound Name | 8-ethoxy-1-(3-hydroxypropyl)-3-methyl-7-[(2E)-3-methyl-2-[(propan-2-ylideneamino)methylidene]but-3-enyl]purine-2,6-dione |
|---|---|
| PubChem CID | 123802920 |
| Molecular Formula | C20H29N5O4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 8-ethoxy-1-(3-hydroxypropyl)-3-methyl-7-[(2E)-3-methyl-2-[(propan-2-ylideneamino)methylidene]but-3-enyl]purine-2,6-dione |
| SMILES | C=C(C)/C(=C\N=C(C)C)Cn1c(OCC)nc2c1c(=O)n(CCCO)c(=O)n2C |
| InChI | InChI=1S/C20H29N5O4/c1-7-29-19-22-17-16(18(27)24(9-8-10-26)20(28)23(17)6)25(19)12-15(13(2)3)11-21-14(4)5/h11,26H,2,7-10,12H2,1,3-6H3/b15-11- |
| InChIKey | LZSUHBFRBACGOZ-PTNGSMBKSA-N |
| XLogP | 1.62 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|