C11H17N4O7P — CID 10831551
2-(8-ethoxy-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl dihydrogen phosphate (PubChem CID 10831551) has the molecular formula C11H17N4O7P and a molecular weight of 348.25 g/mol. Its IUPAC name is 2-(8-ethoxy-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl dihydrogen phosphate.
| Compound Name | 2-(8-ethoxy-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 10831551 |
| Molecular Formula | C11H17N4O7P |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 2-(8-ethoxy-1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl dihydrogen phosphate |
| SMILES | CCOc1nc2c(c(=O)n(C)c(=O)n2C)n1CCOP(=O)(O)O |
| InChI | InChI=1S/C11H17N4O7P/c1-4-21-10-12-8-7(9(16)14(3)11(17)13(8)2)15(10)5-6-22-23(18,19)20/h4-6H2,1-3H3,(H2,18,19,20) |
| InChIKey | VQVDZNOGXSOERF-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|