C26H31ClN4O — CID 129113823
(1S,5R,7R)-9-[2-chloro-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-7-methoxy-9-azatricyclo[3.3.1.02,4]non-2-ene (PubChem CID 129113823) has the molecular formula C26H31ClN4O and a molecular weight of 451.01 g/mol. Its IUPAC name is (1S,5R,7R)-9-[2-chloro-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-7-methoxy-9-azatricyclo[3.3.1.02,4]non-2-ene.
| Compound Name | (1S,5R,7R)-9-[2-chloro-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-7-methoxy-9-azatricyclo[3.3.1.02,4]non-2-ene |
|---|---|
| PubChem CID | 129113823 |
| Molecular Formula | C26H31ClN4O |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (1S,5R,7R)-9-[2-chloro-6-(2-methyl-5-propan-2-ylphenyl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl]-7-methoxy-9-azatricyclo[3.3.1.02,4]non-2-ene |
| SMILES | CO[C@@H]1C[C@@H]2C3C=C3[C@H](C1)N2c1nc(Cl)nc2c1CN(c1cc(C(C)C)ccc1C)CC2 |
| InChI | InChI=1S/C26H31ClN4O/c1-14(2)16-6-5-15(3)22(9-16)30-8-7-21-20(13-30)25(29-26(27)28-21)31-23-10-17(32-4)11-24(31)19-12-18(19)23/h5-6,9,12,14,17-18,23-24H,7-8,10-11,13H2,1-4H3/t17-,18?,23-,24+/m1/s1 |
| InChIKey | WEGIYSIZSFGFRO-VHHYSWJFSA-N |
| XLogP | 5.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|