C32H36FN3O3 — CID 129124917
N-[(2S)-3-[2-[[(2S)-2-(4-fluorophenyl)cyclopropyl]amino]ethoxy]-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-phenylbenzamide (PubChem CID 129124917) has the molecular formula C32H36FN3O3 and a molecular weight of 529.66 g/mol. Its IUPAC name is N-[(2S)-3-[2-[[(2S)-2-(4-fluorophenyl)cyclopropyl]amino]ethoxy]-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-phenylbenzamide.
| Compound Name | N-[(2S)-3-[2-[[(2S)-2-(4-fluorophenyl)cyclopropyl]amino]ethoxy]-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 129124917 |
| Molecular Formula | C32H36FN3O3 |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | N-[(2S)-3-[2-[[(2S)-2-(4-fluorophenyl)cyclopropyl]amino]ethoxy]-1-oxo-1-piperidin-1-ylpropan-2-yl]-4-phenylbenzamide |
| SMILES | O=C(N[C@@H](COCCNC1C[C@H]1c1ccc(F)cc1)C(=O)N1CCCCC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C32H36FN3O3/c33-27-15-13-25(14-16-27)28-21-29(28)34-17-20-39-22-30(32(38)36-18-5-2-6-19-36)35-31(37)26-11-9-24(10-12-26)23-7-3-1-4-8-23/h1,3-4,7-16,28-30,34H,2,5-6,17-22H2,(H,35,37)/t28-,29?,30-/m0/s1 |
| InChIKey | IHIGNISVMBCPQS-ZLZIOLORSA-N |
| XLogP | 4.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|