About 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline
3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline (PubChem CID 129131363) has the molecular formula C16H19N
and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline.
Molecular Properties
| Compound Name | 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline |
| PubChem CID | 129131363 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline |
| SMILES | C=Cc1cccc(N(C)C2=CCC(C)C=C2)c1 |
| InChI | InChI=1S/C16H19N/c1-4-14-6-5-7-16(12-14)17(3)15-10-8-13(2)9-11-15/h4-8,10-13H,1,9H2,2-3H3 |
| InChIKey | IMQKXWHTIRUQBR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
The IUPAC name of 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline (CID 129131363) is 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline.
What is the SMILES notation for 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
The canonical SMILES for 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline is C=Cc1cccc(N(C)C2=CCC(C)C=C2)c1.
What is the InChIKey of 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
The InChIKey is IMQKXWHTIRUQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-4-14-6-5-7-16(12-14)17(3)15-10-8-13(2)9-11-15/h4-8,10-13H,1,9H2,2-3H3.
What are the key properties of 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline?
3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline has a molecular weight of 225.33 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-N-methyl-N-(4-methylcyclohexa-1,5-dien-1-yl)aniline is sourced from PubChem (CID 129131363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).