C15H29N — CID 129131546
(2Z,4Z)-3-tert-butyl-N,4-dimethylnona-2,4-dien-5-amine (PubChem CID 129131546) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (2Z,4Z)-3-tert-butyl-N,4-dimethylnona-2,4-dien-5-amine.
| Compound Name | (2Z,4Z)-3-tert-butyl-N,4-dimethylnona-2,4-dien-5-amine |
|---|---|
| PubChem CID | 129131546 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (2Z,4Z)-3-tert-butyl-N,4-dimethylnona-2,4-dien-5-amine |
| SMILES | C/C=C(C(\C)=C(\CCCC)NC)/C(C)(C)C |
| InChI | InChI=1S/C15H29N/c1-8-10-11-14(16-7)12(3)13(9-2)15(4,5)6/h9,16H,8,10-11H2,1-7H3/b13-9+,14-12- |
| InChIKey | AOQJXPUEVJGICV-CPUWGDESSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|