C14H17N3 — CID 129131695
N,N-dimethyl-4-[1-(3-methylimidazol-4-yl)ethenyl]aniline (PubChem CID 129131695) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is N,N-dimethyl-4-[1-(3-methylimidazol-4-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[1-(3-methylimidazol-4-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 129131695 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | N,N-dimethyl-4-[1-(3-methylimidazol-4-yl)ethenyl]aniline |
| SMILES | C=C(c1ccc(N(C)C)cc1)c1cncn1C |
| InChI | InChI=1S/C14H17N3/c1-11(14-9-15-10-17(14)4)12-5-7-13(8-6-12)16(2)3/h5-10H,1H2,2-4H3 |
| InChIKey | DVJBRFCIFQUMQU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|