C13H17N — CID 168864381
4-(1-cyclopropylethenyl)-N,N-dimethylaniline (PubChem CID 168864381) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-(1-cyclopropylethenyl)-N,N-dimethylaniline.
| Compound Name | 4-(1-cyclopropylethenyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 168864381 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4-(1-cyclopropylethenyl)-N,N-dimethylaniline |
| SMILES | C=C(c1ccc(N(C)C)cc1)C1CC1 |
| InChI | InChI=1S/C13H17N/c1-10(11-4-5-11)12-6-8-13(9-7-12)14(2)3/h6-9,11H,1,4-5H2,2-3H3 |
| InChIKey | NNGYTNXUSKDMAQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|