C15H20O — CID 122206167
1-(1-cyclohexylethenyl)-4-methoxybenzene (PubChem CID 122206167) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(1-cyclohexylethenyl)-4-methoxybenzene.
| Compound Name | 1-(1-cyclohexylethenyl)-4-methoxybenzene |
|---|---|
| PubChem CID | 122206167 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 1-(1-cyclohexylethenyl)-4-methoxybenzene |
| SMILES | C=C(c1ccc(OC)cc1)C1CCCCC1 |
| InChI | InChI=1S/C15H20O/c1-12(13-6-4-3-5-7-13)14-8-10-15(16-2)11-9-14/h8-11,13H,1,3-7H2,2H3 |
| InChIKey | CLUPPXBKZWKJOA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |