C38H46O2 — CID 54529441
1,4-bis[2-cyclohexyl-2-(4-methoxyphenyl)ethenyl]-2,5-dimethylbenzene (PubChem CID 54529441) has the molecular formula C38H46O2 and a molecular weight of 534.78 g/mol. Its IUPAC name is 1,4-bis[2-cyclohexyl-2-(4-methoxyphenyl)ethenyl]-2,5-dimethylbenzene.
| Compound Name | 1,4-bis[2-cyclohexyl-2-(4-methoxyphenyl)ethenyl]-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 54529441 |
| Molecular Formula | C38H46O2 |
| Molecular Weight | 534.78 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | 1,4-bis[2-cyclohexyl-2-(4-methoxyphenyl)ethenyl]-2,5-dimethylbenzene |
| SMILES | COc1ccc(C(=Cc2cc(C)c(C=C(c3ccc(OC)cc3)C3CCCCC3)cc2C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C38H46O2/c1-27-23-34(26-38(30-13-9-6-10-14-30)32-17-21-36(40-4)22-18-32)28(2)24-33(27)25-37(29-11-7-5-8-12-29)31-15-19-35(39-3)20-16-31/h15-26,29-30H,5-14H2,1-4H3 |
| InChIKey | YVLRLUUPWYLLIZ-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.78 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|