C25H27NO5 — CID 152664873
(4-nitrophenyl) (3E,5E)-6-cyclohexyl-6-(4-methoxyphenyl)hexa-3,5-dienoate (PubChem CID 152664873) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (4-nitrophenyl) (3E,5E)-6-cyclohexyl-6-(4-methoxyphenyl)hexa-3,5-dienoate.
| Compound Name | (4-nitrophenyl) (3E,5E)-6-cyclohexyl-6-(4-methoxyphenyl)hexa-3,5-dienoate |
|---|---|
| PubChem CID | 152664873 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (4-nitrophenyl) (3E,5E)-6-cyclohexyl-6-(4-methoxyphenyl)hexa-3,5-dienoate |
| SMILES | COc1ccc(/C(=C/C=C/CC(=O)Oc2ccc([N+](=O)[O-])cc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-30-22-15-11-20(12-16-22)24(19-7-3-2-4-8-19)9-5-6-10-25(27)31-23-17-13-21(14-18-23)26(28)29/h5-6,9,11-19H,2-4,7-8,10H2,1H3/b6-5+,24-9+ |
| InChIKey | ZKHLJCOTMJMKMV-UDBXKHGOSA-N |
| XLogP | 6.12 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|