C24H17Cl2NO4 — CID 151686530
(4-nitrophenyl) (3E)-6,6-bis(4-chlorophenyl)hexa-3,5-dienoate (PubChem CID 151686530) has the molecular formula C24H17Cl2NO4 and a molecular weight of 454.31 g/mol. Its IUPAC name is (4-nitrophenyl) (3E)-6,6-bis(4-chlorophenyl)hexa-3,5-dienoate.
| Compound Name | (4-nitrophenyl) (3E)-6,6-bis(4-chlorophenyl)hexa-3,5-dienoate |
|---|---|
| PubChem CID | 151686530 |
| Molecular Formula | C24H17Cl2NO4 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | (4-nitrophenyl) (3E)-6,6-bis(4-chlorophenyl)hexa-3,5-dienoate |
| SMILES | O=C(C/C=C/C=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H17Cl2NO4/c25-19-9-5-17(6-10-19)23(18-7-11-20(26)12-8-18)3-1-2-4-24(28)31-22-15-13-21(14-16-22)27(29)30/h1-3,5-16H,4H2/b2-1+ |
| InChIKey | RBQUVXFWAWRMBV-OWOJBTEDSA-N |
| XLogP | 6.89 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|