C22H23NO5 — CID 150333476
(4-nitrophenyl) (3E,5Z)-6-(4-methoxyphenyl)-7-methylocta-3,5-dienoate (PubChem CID 150333476) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (4-nitrophenyl) (3E,5Z)-6-(4-methoxyphenyl)-7-methylocta-3,5-dienoate.
| Compound Name | (4-nitrophenyl) (3E,5Z)-6-(4-methoxyphenyl)-7-methylocta-3,5-dienoate |
|---|---|
| PubChem CID | 150333476 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (4-nitrophenyl) (3E,5Z)-6-(4-methoxyphenyl)-7-methylocta-3,5-dienoate |
| SMILES | COc1ccc(/C(=C\C=C\CC(=O)Oc2ccc([N+](=O)[O-])cc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-16(2)21(17-8-12-19(27-3)13-9-17)6-4-5-7-22(24)28-20-14-10-18(11-15-20)23(25)26/h4-6,8-16H,7H2,1-3H3/b5-4+,21-6- |
| InChIKey | GQEGSNLDGXLSCO-LXMZQHMWSA-N |
| XLogP | 5.19 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|