C17H22O2 — CID 141476098
2-cyclohexyl-1-(4-methoxyphenyl)buta-2,3-dien-1-ol (PubChem CID 141476098) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-cyclohexyl-1-(4-methoxyphenyl)buta-2,3-dien-1-ol.
| Compound Name | 2-cyclohexyl-1-(4-methoxyphenyl)buta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 141476098 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-cyclohexyl-1-(4-methoxyphenyl)buta-2,3-dien-1-ol |
| SMILES | C=C=C(C1CCCCC1)C(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H22O2/c1-3-16(13-7-5-4-6-8-13)17(18)14-9-11-15(19-2)12-10-14/h9-13,17-18H,1,4-8H2,2H3 |
| InChIKey | WVPWDLBUIVLIGZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |