C9H13NO — CID 12913257
1,3,4,6-tetramethylpyridin-2-one (PubChem CID 12913257) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is 1,3,4,6-tetramethylpyridin-2-one.
| Compound Name | 1,3,4,6-tetramethylpyridin-2-one |
|---|---|
| PubChem CID | 12913257 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1,3,4,6-tetramethylpyridin-2-one |
| SMILES | Cc1cc(C)n(C)c(=O)c1C |
| InChI | InChI=1S/C9H13NO/c1-6-5-7(2)10(4)9(11)8(6)3/h5H,1-4H3 |
| InChIKey | CWMKSXXMTGIROD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |