C25H17N3 — CID 129133243
3-[3-(5-pyridin-4-yl-3-pyridinyl)phenyl]isoquinoline (PubChem CID 129133243) has the molecular formula C25H17N3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[3-(5-pyridin-4-yl-3-pyridinyl)phenyl]isoquinoline.
| Compound Name | 3-[3-(5-pyridin-4-yl-3-pyridinyl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 129133243 |
| Molecular Formula | C25H17N3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-[3-(5-pyridin-4-yl-3-pyridinyl)phenyl]isoquinoline |
| SMILES | c1cc(-c2cncc(-c3ccncc3)c2)cc(-c2cc3ccccc3cn2)c1 |
| InChI | InChI=1S/C25H17N3/c1-2-5-22-17-28-25(14-20(22)4-1)21-7-3-6-19(12-21)24-13-23(15-27-16-24)18-8-10-26-11-9-18/h1-17H |
| InChIKey | JIQGOZCNKCEPMC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |