C19H20FNO4 — CID 129135031
5-(2-fluoro-4-methylphenyl)-1-(oxan-4-ylmethyl)-4-oxopyridine-3-carboxylic acid (PubChem CID 129135031) has the molecular formula C19H20FNO4 and a molecular weight of 345.37 g/mol. Its IUPAC name is 5-(2-fluoro-4-methylphenyl)-1-(oxan-4-ylmethyl)-4-oxopyridine-3-carboxylic acid.
| Compound Name | 5-(2-fluoro-4-methylphenyl)-1-(oxan-4-ylmethyl)-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 129135031 |
| Molecular Formula | C19H20FNO4 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 5-(2-fluoro-4-methylphenyl)-1-(oxan-4-ylmethyl)-4-oxopyridine-3-carboxylic acid |
| SMILES | Cc1ccc(-c2cn(CC3CCOCC3)cc(C(=O)O)c2=O)c(F)c1 |
| InChI | InChI=1S/C19H20FNO4/c1-12-2-3-14(17(20)8-12)15-10-21(9-13-4-6-25-7-5-13)11-16(18(15)22)19(23)24/h2-3,8,10-11,13H,4-7,9H2,1H3,(H,23,24) |
| InChIKey | SSTACBWUDSOHJH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |