C11H13FO2 — CID 129135375
2-(4-cyclopropyl-2-fluorophenyl)ethane-1,1-diol (PubChem CID 129135375) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is 2-(4-cyclopropyl-2-fluorophenyl)ethane-1,1-diol.
| Compound Name | 2-(4-cyclopropyl-2-fluorophenyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 129135375 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | 2-(4-cyclopropyl-2-fluorophenyl)ethane-1,1-diol |
| SMILES | OC(O)Cc1ccc(C2CC2)cc1F |
| InChI | InChI=1S/C11H13FO2/c12-10-5-8(7-1-2-7)3-4-9(10)6-11(13)14/h3-5,7,11,13-14H,1-2,6H2 |
| InChIKey | TURJAFVIOSHPHE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|