C17H25F — CID 59931429
4-cyclohexyl-2-fluoro-1-pentylbenzene (PubChem CID 59931429) has the molecular formula C17H25F and a molecular weight of 248.38 g/mol. Its IUPAC name is 4-cyclohexyl-2-fluoro-1-pentylbenzene.
| Compound Name | 4-cyclohexyl-2-fluoro-1-pentylbenzene |
|---|---|
| PubChem CID | 59931429 |
| Molecular Formula | C17H25F |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-cyclohexyl-2-fluoro-1-pentylbenzene |
| SMILES | CCCCCc1ccc(C2CCCCC2)cc1F |
| InChI | InChI=1S/C17H25F/c1-2-3-5-10-15-11-12-16(13-17(15)18)14-8-6-4-7-9-14/h11-14H,2-10H2,1H3 |
| InChIKey | WOBGVDJCJIQEGZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|