C24H23N5OS — CID 1291362
2-[[5-(3-aminophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 1291362) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-[[5-(3-aminophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[[5-(3-aminophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 1291362 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[[5-(3-aminophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CSc2nnc(-c3cccc(N)c3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N5OS/c1-17-10-12-18(13-11-17)15-26-22(30)16-31-24-28-27-23(19-6-5-7-20(25)14-19)29(24)21-8-3-2-4-9-21/h2-14H,15-16,25H2,1H3,(H,26,30) |
| InChIKey | HBZUWGKMBLOVJA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|