C25H25N5OS — CID 26443304
N-[[4-(dimethylamino)phenyl]methyl]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 26443304) has the molecular formula C25H25N5OS and a molecular weight of 443.58 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 26443304 |
| Molecular Formula | C25H25N5OS |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CN(C)c1ccc(CNC(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N5OS/c1-29(2)21-15-13-19(14-16-21)17-26-23(31)18-32-25-28-27-24(20-9-5-3-6-10-20)30(25)22-11-7-4-8-12-22/h3-16H,17-18H2,1-2H3,(H,26,31) |
| InChIKey | HWYNBDHZYIFKGA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|