C26H30N2O3 — CID 129136684
4-[2-(2,5-dimethylphenyl)ethyl]-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine (PubChem CID 129136684) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-[2-(2,5-dimethylphenyl)ethyl]-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine.
| Compound Name | 4-[2-(2,5-dimethylphenyl)ethyl]-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine |
|---|---|
| PubChem CID | 129136684 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 4-[2-(2,5-dimethylphenyl)ethyl]-1-[[5-(2-nitrophenyl)furan-2-yl]methyl]piperidine |
| SMILES | Cc1ccc(C)c(CCC2CCN(Cc3ccc(-c4ccccc4[N+](=O)[O-])o3)CC2)c1 |
| InChI | InChI=1S/C26H30N2O3/c1-19-7-8-20(2)22(17-19)10-9-21-13-15-27(16-14-21)18-23-11-12-26(31-23)24-5-3-4-6-25(24)28(29)30/h3-8,11-12,17,21H,9-10,13-16,18H2,1-2H3 |
| InChIKey | AHYNESHHZSMBEH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 59.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|