C34H26Br2O — CID 129138218
bis(4-bromophenyl)-[2-(9,9-dimethylfluoren-2-yl)phenyl]methanol (PubChem CID 129138218) has the molecular formula C34H26Br2O and a molecular weight of 610.39 g/mol. Its IUPAC name is bis(4-bromophenyl)-[2-(9,9-dimethylfluoren-2-yl)phenyl]methanol.
| Compound Name | bis(4-bromophenyl)-[2-(9,9-dimethylfluoren-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 129138218 |
| Molecular Formula | C34H26Br2O |
| Molecular Weight | 610.39 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | bis(4-bromophenyl)-[2-(9,9-dimethylfluoren-2-yl)phenyl]methanol |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3ccccc3C(O)(c3ccc(Br)cc3)c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C34H26Br2O/c1-33(2)30-9-5-4-8-28(30)29-20-11-22(21-32(29)33)27-7-3-6-10-31(27)34(37,23-12-16-25(35)17-13-23)24-14-18-26(36)19-15-24/h3-21,37H,1-2H3 |
| InChIKey | VSSCZPYQOQXVFE-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.39 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|