C26H25F3N8O2 — CID 129139903
2-[2-(2-ethoxyethylamino)-3-pyridinyl]-9-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-7H-purin-8-one (PubChem CID 129139903) has the molecular formula C26H25F3N8O2 and a molecular weight of 538.53 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethylamino)-3-pyridinyl]-9-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-7H-purin-8-one.
| Compound Name | 2-[2-(2-ethoxyethylamino)-3-pyridinyl]-9-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 129139903 |
| Molecular Formula | C26H25F3N8O2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 2-[2-(2-ethoxyethylamino)-3-pyridinyl]-9-[[4-[1-methyl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]-7H-purin-8-one |
| SMILES | CCOCCNc1ncccc1-c1ncc2[nH]c(=O)n(Cc3ccc(-c4nc(C(F)(F)F)cn4C)cc3)c2n1 |
| InChI | InChI=1S/C26H25F3N8O2/c1-3-39-12-11-31-21-18(5-4-10-30-21)22-32-13-19-24(35-22)37(25(38)33-19)14-16-6-8-17(9-7-16)23-34-20(15-36(23)2)26(27,28)29/h4-10,13,15H,3,11-12,14H2,1-2H3,(H,30,31)(H,33,38) |
| InChIKey | RNZXHCFYDBJLOT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|