C23H21OP — CID 12914047
(2R,6R)-1,2,6-triphenylphosphinan-4-one (PubChem CID 12914047) has the molecular formula C23H21OP and a molecular weight of 344.39 g/mol. Its IUPAC name is (2R,6R)-1,2,6-triphenylphosphinan-4-one.
| Compound Name | (2R,6R)-1,2,6-triphenylphosphinan-4-one |
|---|---|
| PubChem CID | 12914047 |
| Molecular Formula | C23H21OP |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (2R,6R)-1,2,6-triphenylphosphinan-4-one |
| SMILES | O=C1C[C@H](c2ccccc2)P(c2ccccc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H21OP/c24-20-16-22(18-10-4-1-5-11-18)25(21-14-8-3-9-15-21)23(17-20)19-12-6-2-7-13-19/h1-15,22-23H,16-17H2/t22-,23-/m1/s1 |
| InChIKey | LQWINIIHGWXQCK-DHIUTWEWSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|