C11H11NO — CID 91380301
2-phenyl-3,5-dihydro-2H-pyridin-4-one (PubChem CID 91380301) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-phenyl-3,5-dihydro-2H-pyridin-4-one.
| Compound Name | 2-phenyl-3,5-dihydro-2H-pyridin-4-one |
|---|---|
| PubChem CID | 91380301 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-phenyl-3,5-dihydro-2H-pyridin-4-one |
| SMILES | O=C1CC=NC(c2ccccc2)C1 |
| InChI | InChI=1S/C11H11NO/c13-10-6-7-12-11(8-10)9-4-2-1-3-5-9/h1-5,7,11H,6,8H2 |
| InChIKey | FLZBZOSQSDEOJB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |