C23H21O2P — CID 12914054
(2R,6S)-1-oxo-1,2,6-triphenyl-1lambda5-phosphinan-4-one (PubChem CID 12914054) has the molecular formula C23H21O2P and a molecular weight of 360.39 g/mol. Its IUPAC name is (2R,6S)-1-oxo-1,2,6-triphenyl-1lambda5-phosphinan-4-one.
| Compound Name | (2R,6S)-1-oxo-1,2,6-triphenyl-1lambda5-phosphinan-4-one |
|---|---|
| PubChem CID | 12914054 |
| Molecular Formula | C23H21O2P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (2R,6S)-1-oxo-1,2,6-triphenyl-1lambda5-phosphinan-4-one |
| SMILES | O=C1C[C@H](c2ccccc2)P(=O)(c2ccccc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C23H21O2P/c24-20-16-22(18-10-4-1-5-11-18)26(25,21-14-8-3-9-15-21)23(17-20)19-12-6-2-7-13-19/h1-15,22-23H,16-17H2/t22-,23+,26? |
| InChIKey | XXQFFTNNKJOESD-XZQOPNAISA-N |
| XLogP | 5.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|