About 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole
2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 129141127) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole.
Analyze 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole (CID 129141127) is 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole is CCC1CN(C2=NCCS2)C1.
What is the InChIKey of 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole?
The InChIKey is GVZGEGTXNXSXIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-2-7-5-10(6-7)8-9-3-4-11-8/h7H,2-6H2,1H3.
What are the key properties of 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole?
2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole has a molecular weight of 170.28 g/mol, XLogP of 1.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylazetidin-1-yl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 129141127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).