About ethyl N-methylazetidine-1-carboximidothioate;propane
ethyl N-methylazetidine-1-carboximidothioate;propane (PubChem CID 144990797) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is ethyl N-methylazetidine-1-carboximidothioate;propane.
Molecular Properties
| Compound Name | ethyl N-methylazetidine-1-carboximidothioate;propane |
| PubChem CID | 144990797 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | ethyl N-methylazetidine-1-carboximidothioate;propane |
| SMILES | CCC.CCS/C(=N\C)N1CCC1 |
| InChI | InChI=1S/C7H14N2S.C3H8/c1-3-10-7(8-2)9-5-4-6-9;1-3-2/h3-6H2,1-2H3;3H2,1-2H3/b8-7-; |
| InChIKey | AGCBCVRGGQLYBX-CFYXSCKTSA-N |
| XLogP | 2.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-methylazetidine-1-carboximidothioate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-methylazetidine-1-carboximidothioate;propane?
The IUPAC name of ethyl N-methylazetidine-1-carboximidothioate;propane (CID 144990797) is ethyl N-methylazetidine-1-carboximidothioate;propane.
What is the SMILES notation for ethyl N-methylazetidine-1-carboximidothioate;propane?
The canonical SMILES for ethyl N-methylazetidine-1-carboximidothioate;propane is CCC.CCS/C(=N\C)N1CCC1.
What is the InChIKey of ethyl N-methylazetidine-1-carboximidothioate;propane?
The InChIKey is AGCBCVRGGQLYBX-CFYXSCKTSA-N. The full InChI is InChI=1S/C7H14N2S.C3H8/c1-3-10-7(8-2)9-5-4-6-9;1-3-2/h3-6H2,1-2H3;3H2,1-2H3/b8-7-;.
What are the key properties of ethyl N-methylazetidine-1-carboximidothioate;propane?
ethyl N-methylazetidine-1-carboximidothioate;propane has a molecular weight of 202.37 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-methylazetidine-1-carboximidothioate;propane is sourced from PubChem (CID 144990797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).