About [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate
[2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate (PubChem CID 129144378) has the molecular formula C14H14BrNO3
and a molecular weight of 324.17 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate |
| PubChem CID | 129144378 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate |
| SMILES | CC1=C[C@@H](C(=O)OCC(=O)c2ccc(Br)cc2)NC1 |
| InChI | InChI=1S/C14H14BrNO3/c1-9-6-12(16-7-9)14(18)19-8-13(17)10-2-4-11(15)5-3-10/h2-6,12,16H,7-8H2,1H3/t12-/m0/s1 |
| InChIKey | MFCWUEHVRNAWCA-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate?
The IUPAC name of [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate (CID 129144378) is [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate.
What is the SMILES notation for [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate?
The canonical SMILES for [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate is CC1=C[C@@H](C(=O)OCC(=O)c2ccc(Br)cc2)NC1.
What is the InChIKey of [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate?
The InChIKey is MFCWUEHVRNAWCA-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H14BrNO3/c1-9-6-12(16-7-9)14(18)19-8-13(17)10-2-4-11(15)5-3-10/h2-6,12,16H,7-8H2,1H3/t12-/m0/s1.
What are the key properties of [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate?
[2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate has a molecular weight of 324.17 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 129144378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).