C14H14BrNO3 — CID 129144378
[2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate (PubChem CID 129144378) has the molecular formula C14H14BrNO3 and a molecular weight of 324.17 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 129144378 |
| Molecular Formula | C14H14BrNO3 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] (2S)-4-methyl-2,5-dihydro-1H-pyrrole-2-carboxylate |
| SMILES | CC1=C[C@@H](C(=O)OCC(=O)c2ccc(Br)cc2)NC1 |
| InChI | InChI=1S/C14H14BrNO3/c1-9-6-12(16-7-9)14(18)19-8-13(17)10-2-4-11(15)5-3-10/h2-6,12,16H,7-8H2,1H3/t12-/m0/s1 |
| InChIKey | MFCWUEHVRNAWCA-LBPRGKRZSA-N |
| XLogP | 2.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|