C21H21NO4 — CID 129144685
methyl 5-(6-amino-3-methoxy-2,4-dimethylphenyl)-6-hydroxynaphthalene-2-carboxylate (PubChem CID 129144685) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl 5-(6-amino-3-methoxy-2,4-dimethylphenyl)-6-hydroxynaphthalene-2-carboxylate.
| Compound Name | methyl 5-(6-amino-3-methoxy-2,4-dimethylphenyl)-6-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 129144685 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl 5-(6-amino-3-methoxy-2,4-dimethylphenyl)-6-hydroxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3c(N)cc(C)c(OC)c3C)c(O)ccc2c1 |
| InChI | InChI=1S/C21H21NO4/c1-11-9-16(22)18(12(2)20(11)25-3)19-15-7-5-14(21(24)26-4)10-13(15)6-8-17(19)23/h5-10,23H,22H2,1-4H3 |
| InChIKey | RJLHGRHFQGXEGK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|